C24H20N2O4 — CID 137049892
N-benzyl-3-hydroxy-1-oxo-2-phenylmethoxyisoquinoline-4-carboxamide (PubChem CID 137049892) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is N-benzyl-3-hydroxy-1-oxo-2-phenylmethoxyisoquinoline-4-carboxamide.
| Compound Name | N-benzyl-3-hydroxy-1-oxo-2-phenylmethoxyisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 137049892 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-benzyl-3-hydroxy-1-oxo-2-phenylmethoxyisoquinoline-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1c(O)n(OCc2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C24H20N2O4/c27-22(25-15-17-9-3-1-4-10-17)21-19-13-7-8-14-20(19)23(28)26(24(21)29)30-16-18-11-5-2-6-12-18/h1-14,29H,15-16H2,(H,25,27) |
| InChIKey | MVPZIJVNRPXQGF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |