C21H17N3O2 — CID 14987229
N-benzyl-2-hydroxy-1-phenylpyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 14987229) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-benzyl-2-hydroxy-1-phenylpyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | N-benzyl-2-hydroxy-1-phenylpyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 14987229 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-benzyl-2-hydroxy-1-phenylpyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1c(O)n(-c2ccccc2)c2ncccc12 |
| InChI | InChI=1S/C21H17N3O2/c25-20(23-14-15-8-3-1-4-9-15)18-17-12-7-13-22-19(17)24(21(18)26)16-10-5-2-6-11-16/h1-13,26H,14H2,(H,23,25) |
| InChIKey | QRVJXZPNPMQZFE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |