C13H11NO3 — CID 22157618
N-benzyl-3,4-dioxocyclopentene-1-carboxamide (PubChem CID 22157618) has the molecular formula C13H11NO3 and a molecular weight of 229.24 g/mol. Its IUPAC name is N-benzyl-3,4-dioxocyclopentene-1-carboxamide.
| Compound Name | N-benzyl-3,4-dioxocyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 22157618 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N-benzyl-3,4-dioxocyclopentene-1-carboxamide |
| SMILES | O=C1C=C(C(=O)NCc2ccccc2)CC1=O |
| InChI | InChI=1S/C13H11NO3/c15-11-6-10(7-12(11)16)13(17)14-8-9-4-2-1-3-5-9/h1-6H,7-8H2,(H,14,17) |
| InChIKey | OIOBNAMIBFGLFE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|