C11H11N3O2 — CID 110467706
N-benzyl-5-oxo-1,4-dihydropyrazole-3-carboxamide (PubChem CID 110467706) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is N-benzyl-5-oxo-1,4-dihydropyrazole-3-carboxamide.
| Compound Name | N-benzyl-5-oxo-1,4-dihydropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110467706 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-benzyl-5-oxo-1,4-dihydropyrazole-3-carboxamide |
| SMILES | O=C1CC(C(=O)NCc2ccccc2)=NN1 |
| InChI | InChI=1S/C11H11N3O2/c15-10-6-9(13-14-10)11(16)12-7-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,16)(H,14,15) |
| InChIKey | DYAYHTPXAPALMU-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |