C22H26N2O3 — CID 69091548
3-N-benzyl-2-cyclohexyl-4-methoxybenzene-1,3-dicarboxamide (PubChem CID 69091548) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-N-benzyl-2-cyclohexyl-4-methoxybenzene-1,3-dicarboxamide.
| Compound Name | 3-N-benzyl-2-cyclohexyl-4-methoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 69091548 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-N-benzyl-2-cyclohexyl-4-methoxybenzene-1,3-dicarboxamide |
| SMILES | COc1ccc(C(N)=O)c(C2CCCCC2)c1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O3/c1-27-18-13-12-17(21(23)25)19(16-10-6-3-7-11-16)20(18)22(26)24-14-15-8-4-2-5-9-15/h2,4-5,8-9,12-13,16H,3,6-7,10-11,14H2,1H3,(H2,23,25)(H,24,26) |
| InChIKey | KKAXKQTYKMERFV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |