C21H20N2O4 — CID 25096901
N-benzyl-6-(3,4-dimethoxyphenyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 25096901) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is N-benzyl-6-(3,4-dimethoxyphenyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-benzyl-6-(3,4-dimethoxyphenyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25096901 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-benzyl-6-(3,4-dimethoxyphenyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | COc1ccc(-c2ccc(C(=O)NCc3ccccc3)c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C21H20N2O4/c1-26-18-11-8-15(12-19(18)27-2)17-10-9-16(21(25)23-17)20(24)22-13-14-6-4-3-5-7-14/h3-12H,13H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | JBTWYGSFIBDDSC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |