C18H13N3O2 — CID 66497426
N-(cyanomethyl)-6-naphthalen-2-yl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 66497426) has the molecular formula C18H13N3O2 and a molecular weight of 303.32 g/mol. Its IUPAC name is N-(cyanomethyl)-6-naphthalen-2-yl-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(cyanomethyl)-6-naphthalen-2-yl-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66497426 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(cyanomethyl)-6-naphthalen-2-yl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | N#CCNC(=O)c1ccc(-c2ccc3ccccc3c2)[nH]c1=O |
| InChI | InChI=1S/C18H13N3O2/c19-9-10-20-17(22)15-7-8-16(21-18(15)23)14-6-5-12-3-1-2-4-13(12)11-14/h1-8,11H,10H2,(H,20,22)(H,21,23) |
| InChIKey | XMPHVSQPLZVULW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|