C15H13N3O2 — CID 129350671
N-(2-cyanoethyl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide (PubChem CID 129350671) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-cyanoethyl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129350671 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-(2-cyanoethyl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide |
| SMILES | N#CCCNC(=O)c1ccc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C15H13N3O2/c16-9-4-10-17-14(19)12-7-8-13(18-15(12)20)11-5-2-1-3-6-11/h1-3,5-8H,4,10H2,(H,17,19)(H,18,20) |
| InChIKey | WYHCQMBAVFJHQS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|