C15H12FN3O2 — CID 125491034
N-(2-cyanoethyl)-6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 125491034) has the molecular formula C15H12FN3O2 and a molecular weight of 285.28 g/mol. Its IUPAC name is N-(2-cyanoethyl)-6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-cyanoethyl)-6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 125491034 |
| Molecular Formula | C15H12FN3O2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-(2-cyanoethyl)-6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | N#CCCNC(=O)c1ccc(-c2ccc(F)cc2)[nH]c1=O |
| InChI | InChI=1S/C15H12FN3O2/c16-11-4-2-10(3-5-11)13-7-6-12(15(21)19-13)14(20)18-9-1-8-17/h2-7H,1,9H2,(H,18,20)(H,19,21) |
| InChIKey | PDLLLQRDYVRIOT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|