C13H10FNO3 — CID 66489830
methyl 6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 66489830) has the molecular formula C13H10FNO3 and a molecular weight of 247.22 g/mol. Its IUPAC name is methyl 6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | methyl 6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 66489830 |
| Molecular Formula | C13H10FNO3 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | methyl 6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(-c2ccc(F)cc2)[nH]c1=O |
| InChI | InChI=1S/C13H10FNO3/c1-18-13(17)10-6-7-11(15-12(10)16)8-2-4-9(14)5-3-8/h2-7H,1H3,(H,15,16) |
| InChIKey | YEVGBEQKHJFPHL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |