C22H21NO5 — CID 51039429
N-benzyl-2-hydroxy-4-(4-hydroxy-3,5-dimethoxyphenyl)benzamide (PubChem CID 51039429) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is N-benzyl-2-hydroxy-4-(4-hydroxy-3,5-dimethoxyphenyl)benzamide.
| Compound Name | N-benzyl-2-hydroxy-4-(4-hydroxy-3,5-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 51039429 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-benzyl-2-hydroxy-4-(4-hydroxy-3,5-dimethoxyphenyl)benzamide |
| SMILES | COc1cc(-c2ccc(C(=O)NCc3ccccc3)c(O)c2)cc(OC)c1O |
| InChI | InChI=1S/C22H21NO5/c1-27-19-11-16(12-20(28-2)21(19)25)15-8-9-17(18(24)10-15)22(26)23-13-14-6-4-3-5-7-14/h3-12,24-25H,13H2,1-2H3,(H,23,26) |
| InChIKey | XGHKGNLWTRRFHW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |