C21H24N2O3 — CID 87690599
2-N-benzyl-3-cyclopentyl-2-N-methoxybenzene-1,2-dicarboxamide (PubChem CID 87690599) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-N-benzyl-3-cyclopentyl-2-N-methoxybenzene-1,2-dicarboxamide.
| Compound Name | 2-N-benzyl-3-cyclopentyl-2-N-methoxybenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87690599 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-N-benzyl-3-cyclopentyl-2-N-methoxybenzene-1,2-dicarboxamide |
| SMILES | CON(Cc1ccccc1)C(=O)c1c(C(N)=O)cccc1C1CCCC1 |
| InChI | InChI=1S/C21H24N2O3/c1-26-23(14-15-8-3-2-4-9-15)21(25)19-17(16-10-5-6-11-16)12-7-13-18(19)20(22)24/h2-4,7-9,12-13,16H,5-6,10-11,14H2,1H3,(H2,22,24) |
| InChIKey | XIMZANTYJGXKHX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|