C16H16N2O3 — CID 71680913
3-N-hydroxy-1-N-(2-phenylethyl)benzene-1,3-dicarboxamide (PubChem CID 71680913) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-N-hydroxy-1-N-(2-phenylethyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-hydroxy-1-N-(2-phenylethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 71680913 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-N-hydroxy-1-N-(2-phenylethyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(NO)c1cccc(C(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C16H16N2O3/c19-15(17-10-9-12-5-2-1-3-6-12)13-7-4-8-14(11-13)16(20)18-21/h1-8,11,21H,9-10H2,(H,17,19)(H,18,20) |
| InChIKey | FIHKWEQJEDRIFS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|