C18H25ClN7O2+ — CID 58398769
2-benzamidoethyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium (PubChem CID 58398769) has the molecular formula C18H25ClN7O2+ and a molecular weight of 406.90 g/mol. Its IUPAC name is 2-benzamidoethyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium.
| Compound Name | 2-benzamidoethyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 58398769 |
| Molecular Formula | C18H25ClN7O2+ |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-benzamidoethyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCNC(=O)c1ccccc1)CCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C18H24ClN7O2/c1-26(2,10-8-22-17(27)12-6-4-3-5-7-12)11-9-23-18(28)13-15(20)25-16(21)14(19)24-13/h3-7H,8-11H2,1-2H3,(H5-,20,21,22,23,25,27,28)/p+1 |
| InChIKey | YMEANOILMASFLY-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|