C17H25ClN7O3S+ — CID 58398849
2-(benzenesulfonamido)ethyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium (PubChem CID 58398849) has the molecular formula C17H25ClN7O3S+ and a molecular weight of 442.95 g/mol. Its IUPAC name is 2-(benzenesulfonamido)ethyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium.
| Compound Name | 2-(benzenesulfonamido)ethyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 58398849 |
| Molecular Formula | C17H25ClN7O3S+ |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-(benzenesulfonamido)ethyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCNC(=O)c1nc(Cl)c(N)nc1N)CCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H24ClN7O3S/c1-25(2,11-9-22-29(27,28)12-6-4-3-5-7-12)10-8-21-17(26)13-15(19)24-16(20)14(18)23-13/h3-7,22H,8-11H2,1-2H3,(H4-,19,20,21,24,26)/p+1 |
| InChIKey | RTRVXGLVDNPUQE-UHFFFAOYSA-O |
| XLogP | 0.08 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|