C23H24ClF3N8O6S — CID 87764752
3,5-diamino-6-chloro-N-[N'-[2-[(4-phenylmethoxyphenyl)sulfonylamino]ethyl]carbamimidoyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 87764752) has the molecular formula C23H24ClF3N8O6S and a molecular weight of 633.01 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[2-[(4-phenylmethoxyphenyl)sulfonylamino]ethyl]carbamimidoyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[2-[(4-phenylmethoxyphenyl)sulfonylamino]ethyl]carbamimidoyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87764752 |
| Molecular Formula | C23H24ClF3N8O6S |
| Molecular Weight | 633.01 g/mol |
| Exact Mass | 632.12 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[2-[(4-phenylmethoxyphenyl)sulfonylamino]ethyl]carbamimidoyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | N/C(=N\CCNS(=O)(=O)c1ccc(OCc2ccccc2)cc1)NC(=O)c1nc(Cl)c(N)nc1N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23ClN8O4S.C2HF3O2/c22-17-19(24)29-18(23)16(28-17)20(31)30-21(25)26-10-11-27-35(32,33)15-8-6-14(7-9-15)34-12-13-4-2-1-3-5-13;3-2(4,5)1(6)7/h1-9,27H,10-12H2,(H4,23,24,29)(H3,25,26,30,31);(H,6,7) |
| InChIKey | HDTYWLHLYAAUTJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 238.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.01 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|