C29H29ClN8O4 — CID 23628131
3,5-diamino-N-[N'-[2-[[3,5-bis(phenylmethoxy)benzoyl]amino]ethyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 23628131) has the molecular formula C29H29ClN8O4 and a molecular weight of 589.06 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[2-[[3,5-bis(phenylmethoxy)benzoyl]amino]ethyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[2-[[3,5-bis(phenylmethoxy)benzoyl]amino]ethyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 23628131 |
| Molecular Formula | C29H29ClN8O4 |
| Molecular Weight | 589.06 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 3,5-diamino-N-[N'-[2-[[3,5-bis(phenylmethoxy)benzoyl]amino]ethyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | N/C(=N\CCNC(=O)c1cc(OCc2ccccc2)cc(OCc2ccccc2)c1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C29H29ClN8O4/c30-24-26(32)37-25(31)23(36-24)28(40)38-29(33)35-12-11-34-27(39)20-13-21(41-16-18-7-3-1-4-8-18)15-22(14-20)42-17-19-9-5-2-6-10-19/h1-10,13-15H,11-12,16-17H2,(H,34,39)(H4,31,32,37)(H3,33,35,38,40) |
| InChIKey | JKAYQGGJUCLAES-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 192.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.06 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|