C29H39ClN8O — CID 118148639
3,5-diamino-6-chloro-N-[N'-[4-[4-[3-[methyl(3-phenylpropyl)amino]propyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 118148639) has the molecular formula C29H39ClN8O and a molecular weight of 551.14 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[3-[methyl(3-phenylpropyl)amino]propyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[3-[methyl(3-phenylpropyl)amino]propyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118148639 |
| Molecular Formula | C29H39ClN8O |
| Molecular Weight | 551.14 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[3-[methyl(3-phenylpropyl)amino]propyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CN(CCCc1ccccc1)CCCc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C29H39ClN8O/c1-38(19-7-12-21-9-3-2-4-10-21)20-8-13-23-16-14-22(15-17-23)11-5-6-18-34-29(33)37-28(39)24-26(31)36-27(32)25(30)35-24/h2-4,9-10,14-17H,5-8,11-13,18-20H2,1H3,(H4,31,32,36)(H3,33,34,37,39) |
| InChIKey | DNGWGFIBOMMQQS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.14 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|