C19H26ClN9O — CID 59750581
3,5-diamino-N-[N'-[4-[4-[(1-aminoethylideneamino)methyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 59750581) has the molecular formula C19H26ClN9O and a molecular weight of 431.93 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[4-[(1-aminoethylideneamino)methyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[4-[(1-aminoethylideneamino)methyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59750581 |
| Molecular Formula | C19H26ClN9O |
| Molecular Weight | 431.93 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[4-[(1-aminoethylideneamino)methyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | C/C(N)=N\Cc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C19H26ClN9O/c1-11(21)26-10-13-7-5-12(6-8-13)4-2-3-9-25-19(24)29-18(30)14-16(22)28-17(23)15(20)27-14/h5-8H,2-4,9-10H2,1H3,(H2,21,26)(H4,22,23,28)(H3,24,25,29,30) |
| InChIKey | GSLMIKCTOIDFAT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 183.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.93 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|