C23H32ClN7O2 — CID 59750586
3,5-diamino-6-chloro-N-[N'-[4-[4-(5-methylhex-5-enoxy)phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 59750586) has the molecular formula C23H32ClN7O2 and a molecular weight of 474.01 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-(5-methylhex-5-enoxy)phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-(5-methylhex-5-enoxy)phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59750586 |
| Molecular Formula | C23H32ClN7O2 |
| Molecular Weight | 474.01 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-(5-methylhex-5-enoxy)phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | C=C(C)CCCCOc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C23H32ClN7O2/c1-15(2)7-4-6-14-33-17-11-9-16(10-12-17)8-3-5-13-28-23(27)31-22(32)18-20(25)30-21(26)19(24)29-18/h9-12H,1,3-8,13-14H2,2H3,(H4,25,26,30)(H3,27,28,31,32) |
| InChIKey | KZWPSKZHMLIQQX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.01 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|