C19H24ClN7O5 — CID 24752893
(2S)-3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]-2-hydroxypropanoic acid (PubChem CID 24752893) has the molecular formula C19H24ClN7O5 and a molecular weight of 465.90 g/mol. Its IUPAC name is (2S)-3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 24752893 |
| Molecular Formula | C19H24ClN7O5 |
| Molecular Weight | 465.90 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (2S)-3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]-2-hydroxypropanoic acid |
| SMILES | N/C(=N\CCCCc1ccc(OC[C@H](O)C(=O)O)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C19H24ClN7O5/c20-14-16(22)26-15(21)13(25-14)17(29)27-19(23)24-8-2-1-3-10-4-6-11(7-5-10)32-9-12(28)18(30)31/h4-7,12,28H,1-3,8-9H2,(H,30,31)(H4,21,22,26)(H3,23,24,27,29)/t12-/m0/s1 |
| InChIKey | CPAFROXGVFVAKG-LBPRGKRZSA-N |
| XLogP | 0.19 |
| TPSA | 212.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.90 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|