C28H45ClN8O10 — CID 10175639
3,5-diamino-N-[N'-[4-[4-[2-[bis[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 10175639) has the molecular formula C28H45ClN8O10 and a molecular weight of 689.17 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[4-[2-[bis[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[4-[2-[bis[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 10175639 |
| Molecular Formula | C28H45ClN8O10 |
| Molecular Weight | 689.17 g/mol |
| Exact Mass | 688.29 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[4-[2-[bis[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCc1ccc(OCCN(C[C@@H](O)[C@H](O)[C@H](O)CO)C[C@@H](O)[C@H](O)[C@H](O)CO)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C28H45ClN8O10/c29-24-26(31)35-25(30)21(34-24)27(46)36-28(32)33-8-2-1-3-15-4-6-16(7-5-15)47-10-9-37(11-17(40)22(44)19(42)13-38)12-18(41)23(45)20(43)14-39/h4-7,17-20,22-23,38-45H,1-3,8-14H2,(H4,30,31,35)(H3,32,33,36,46)/t17-,18-,19-,20-,22+,23+/m1/s1 |
| InChIKey | MPOSAMHLYZCMTB-HUCDYXQFSA-N |
| XLogP | -3.81 |
| TPSA | 319.61 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.17 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|