C26H43Cl3N8O8 — CID 87372585
3,5-diamino-N-[N'-[4-[4-[2-[bis[(2R,3S)-2,3,4-trihydroxybutyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide;dihydrochloride (PubChem CID 87372585) has the molecular formula C26H43Cl3N8O8 and a molecular weight of 702.04 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[4-[2-[bis[(2R,3S)-2,3,4-trihydroxybutyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide;dihydrochloride.
| Compound Name | 3,5-diamino-N-[N'-[4-[4-[2-[bis[(2R,3S)-2,3,4-trihydroxybutyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 87372585 |
| Molecular Formula | C26H43Cl3N8O8 |
| Molecular Weight | 702.04 g/mol |
| Exact Mass | 700.23 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[4-[2-[bis[(2R,3S)-2,3,4-trihydroxybutyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N\CCCCc1ccc(OCCN(C[C@@H](O)[C@@H](O)CO)C[C@@H](O)[C@@H](O)CO)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C26H41ClN8O8.2ClH/c27-22-24(29)33-23(28)21(32-22)25(42)34-26(30)31-8-2-1-3-15-4-6-16(7-5-15)43-10-9-35(11-17(38)19(40)13-36)12-18(39)20(41)14-37;;/h4-7,17-20,36-41H,1-3,8-14H2,(H4,28,29,33)(H3,30,31,34,42);2*1H/t17-,18-,19+,20+;;/m1../s1 |
| InChIKey | MJJKJZHBSDOXKP-LRYKGSQRSA-N |
| XLogP | -1.69 |
| TPSA | 279.15 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.04 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|