C27H41ClN8O8 — CID 139378724
3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[[(2S,3R)-2,3,4-trihydroxybutyl]-[(2S)-2,3,5-trihydroxypent-3-enyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 139378724) has the molecular formula C27H41ClN8O8 and a molecular weight of 641.13 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[[(2S,3R)-2,3,4-trihydroxybutyl]-[(2S)-2,3,5-trihydroxypent-3-enyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[[(2S,3R)-2,3,4-trihydroxybutyl]-[(2S)-2,3,5-trihydroxypent-3-enyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 139378724 |
| Molecular Formula | C27H41ClN8O8 |
| Molecular Weight | 641.13 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[[(2S,3R)-2,3,4-trihydroxybutyl]-[(2S)-2,3,5-trihydroxypent-3-enyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCc1ccc(OCCN(C[C@H](O)C(O)=CCO)C[C@H](O)[C@H](O)CO)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C27H41ClN8O8/c28-23-25(30)34-24(29)22(33-23)26(43)35-27(31)32-9-2-1-3-16-4-6-17(7-5-16)44-12-10-36(14-20(41)21(42)15-38)13-19(40)18(39)8-11-37/h4-8,19-21,37-42H,1-3,9-15H2,(H4,29,30,34)(H3,31,32,35,43)/t19-,20-,21+/m0/s1 |
| InChIKey | QZFUYYDXQSGFPF-PCCBWWKXSA-N |
| XLogP | -1.45 |
| TPSA | 279.15 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.13 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|