C26H41ClN8O5 — CID 142276310
3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[[(3S)-3,4-dihydroxybutyl]-[(3R)-3-hydroxybutyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 142276310) has the molecular formula C26H41ClN8O5 and a molecular weight of 581.12 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[[(3S)-3,4-dihydroxybutyl]-[(3R)-3-hydroxybutyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[[(3S)-3,4-dihydroxybutyl]-[(3R)-3-hydroxybutyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 142276310 |
| Molecular Formula | C26H41ClN8O5 |
| Molecular Weight | 581.12 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[[(3S)-3,4-dihydroxybutyl]-[(3R)-3-hydroxybutyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | C[C@@H](O)CCN(CCOc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1)CC[C@H](O)CO |
| InChI | InChI=1S/C26H41ClN8O5/c1-17(37)9-12-35(13-10-19(38)16-36)14-15-40-20-7-5-18(6-8-20)4-2-3-11-31-26(30)34-25(39)21-23(28)33-24(29)22(27)32-21/h5-8,17,19,36-38H,2-4,9-16H2,1H3,(H4,28,29,33)(H3,30,31,34,39)/t17-,19+/m1/s1 |
| InChIKey | JBQGCTZTBYKPQQ-MJGOQNOKSA-N |
| XLogP | 0.56 |
| TPSA | 218.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.12 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|