C34H48ClN7O8 — CID 118148732
3-amino-6-chloro-5-methyl-N-[N'-[4-[4-[2-[2,3,4,5,6-pentahydroxyhexyl(3-phenoxypropyl)amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 118148732) has the molecular formula C34H48ClN7O8 and a molecular weight of 718.25 g/mol. Its IUPAC name is 3-amino-6-chloro-5-methyl-N-[N'-[4-[4-[2-[2,3,4,5,6-pentahydroxyhexyl(3-phenoxypropyl)amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-chloro-5-methyl-N-[N'-[4-[4-[2-[2,3,4,5,6-pentahydroxyhexyl(3-phenoxypropyl)amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118148732 |
| Molecular Formula | C34H48ClN7O8 |
| Molecular Weight | 718.25 g/mol |
| Exact Mass | 717.33 |
| IUPAC Name | 3-amino-6-chloro-5-methyl-N-[N'-[4-[4-[2-[2,3,4,5,6-pentahydroxyhexyl(3-phenoxypropyl)amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | Cc1nc(N)c(C(=O)N/C(N)=N/CCCCc2ccc(OCCN(CCCOc3ccccc3)CC(O)C(O)C(O)C(O)CO)cc2)nc1Cl |
| InChI | InChI=1S/C34H48ClN7O8/c1-22-31(35)40-28(32(36)39-22)33(48)41-34(37)38-15-6-5-8-23-11-13-25(14-12-23)50-19-17-42(16-7-18-49-24-9-3-2-4-10-24)20-26(44)29(46)30(47)27(45)21-43/h2-4,9-14,26-27,29-30,43-47H,5-8,15-21H2,1H3,(H2,36,39)(H3,37,38,41,48) |
| InChIKey | XYSONWJVLBMWBL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 242.13 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|