C32H49ClN8O7 — CID 155053485
3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[[(2S,3S,4S,5S)-3,5-diformyl-2,4,6-trihydroxyhexyl]-hexylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 155053485) has the molecular formula C32H49ClN8O7 and a molecular weight of 693.25 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[[(2S,3S,4S,5S)-3,5-diformyl-2,4,6-trihydroxyhexyl]-hexylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[[(2S,3S,4S,5S)-3,5-diformyl-2,4,6-trihydroxyhexyl]-hexylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 155053485 |
| Molecular Formula | C32H49ClN8O7 |
| Molecular Weight | 693.25 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[[(2S,3S,4S,5S)-3,5-diformyl-2,4,6-trihydroxyhexyl]-hexylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CCCCCCN(CCOc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1)C[C@@H](O)[C@@H](C=O)[C@@H](O)[C@@H](C=O)CO |
| InChI | InChI=1S/C32H49ClN8O7/c1-2-3-4-7-14-41(17-25(45)24(20-44)27(46)22(18-42)19-43)15-16-48-23-11-9-21(10-12-23)8-5-6-13-37-32(36)40-31(47)26-29(34)39-30(35)28(33)38-26/h9-12,18,20,22,24-25,27,43,45-46H,2-8,13-17,19H2,1H3,(H4,34,35,39)(H3,36,37,40,47)/t22-,24+,25+,27-/m0/s1 |
| InChIKey | FPQXCJKZCNSRHO-TUPPOGIXSA-N |
| XLogP | 0.97 |
| TPSA | 252.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|