C36H60ClN9O7 — CID 90223904
3-amino-N-[N'-[4-[4-[4-amino-3-[3-[hexyl(2,3,4,5,6-pentahydroxyhexyl)amino]propylamino]-4-oxobutyl]phenyl]butyl]carbamimidoyl]-6-chloro-5-methylpyrazine-2-carboxamide (PubChem CID 90223904) has the molecular formula C36H60ClN9O7 and a molecular weight of 766.38 g/mol. Its IUPAC name is 3-amino-N-[N'-[4-[4-[4-amino-3-[3-[hexyl(2,3,4,5,6-pentahydroxyhexyl)amino]propylamino]-4-oxobutyl]phenyl]butyl]carbamimidoyl]-6-chloro-5-methylpyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[N'-[4-[4-[4-amino-3-[3-[hexyl(2,3,4,5,6-pentahydroxyhexyl)amino]propylamino]-4-oxobutyl]phenyl]butyl]carbamimidoyl]-6-chloro-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90223904 |
| Molecular Formula | C36H60ClN9O7 |
| Molecular Weight | 766.38 g/mol |
| Exact Mass | 765.43 |
| IUPAC Name | 3-amino-N-[N'-[4-[4-[4-amino-3-[3-[hexyl(2,3,4,5,6-pentahydroxyhexyl)amino]propylamino]-4-oxobutyl]phenyl]butyl]carbamimidoyl]-6-chloro-5-methylpyrazine-2-carboxamide |
| SMILES | CCCCCCN(CCCNC(CCc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(C)nc2N)cc1)C(N)=O)CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C36H60ClN9O7/c1-3-4-5-8-19-46(21-27(48)30(50)31(51)28(49)22-47)20-9-18-41-26(34(39)52)16-15-25-13-11-24(12-14-25)10-6-7-17-42-36(40)45-35(53)29-33(38)43-23(2)32(37)44-29/h11-14,26-28,30-31,41,47-51H,3-10,15-22H2,1-2H3,(H2,38,43)(H2,39,52)(H3,40,42,45,53) |
| InChIKey | JDCMEPXYLOOFHN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 278.79 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|