C35H50ClN7O6 — CID 118148733
3-amino-6-chloro-5-methyl-N-[N'-[4-[4-[3-[2,3,4,5,6-pentahydroxyhexyl(3-phenylpropyl)amino]propyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 118148733) has the molecular formula C35H50ClN7O6 and a molecular weight of 700.28 g/mol. Its IUPAC name is 3-amino-6-chloro-5-methyl-N-[N'-[4-[4-[3-[2,3,4,5,6-pentahydroxyhexyl(3-phenylpropyl)amino]propyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-chloro-5-methyl-N-[N'-[4-[4-[3-[2,3,4,5,6-pentahydroxyhexyl(3-phenylpropyl)amino]propyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118148733 |
| Molecular Formula | C35H50ClN7O6 |
| Molecular Weight | 700.28 g/mol |
| Exact Mass | 699.35 |
| IUPAC Name | 3-amino-6-chloro-5-methyl-N-[N'-[4-[4-[3-[2,3,4,5,6-pentahydroxyhexyl(3-phenylpropyl)amino]propyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | Cc1nc(N)c(C(=O)N/C(N)=N/CCCCc2ccc(CCCN(CCCc3ccccc3)CC(O)C(O)C(O)C(O)CO)cc2)nc1Cl |
| InChI | InChI=1S/C35H50ClN7O6/c1-23-32(36)41-29(33(37)40-23)34(49)42-35(38)39-18-6-5-11-25-14-16-26(17-15-25)13-8-20-43(19-7-12-24-9-3-2-4-10-24)21-27(45)30(47)31(48)28(46)22-44/h2-4,9-10,14-17,27-28,30-31,44-48H,5-8,11-13,18-22H2,1H3,(H2,37,40)(H3,38,39,42,49) |
| InChIKey | HDZCTWJKUPJLKE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 223.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|