C21H31ClN8O3 — CID 142276304
3,5-diamino-6-chloro-N-[N'-[4-[4-[2-(2-methoxyethylamino)ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 142276304) has the molecular formula C21H31ClN8O3 and a molecular weight of 478.99 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-(2-methoxyethylamino)ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-(2-methoxyethylamino)ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 142276304 |
| Molecular Formula | C21H31ClN8O3 |
| Molecular Weight | 478.99 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-(2-methoxyethylamino)ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | COCCNCCOc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C21H31ClN8O3/c1-32-12-10-26-11-13-33-15-7-5-14(6-8-15)4-2-3-9-27-21(25)30-20(31)16-18(23)29-19(24)17(22)28-16/h5-8,26H,2-4,9-13H2,1H3,(H4,23,24,29)(H3,25,27,30,31) |
| InChIKey | ODLVOHFAQDLYBU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 175.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.99 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|