C24H35ClN8O5 — CID 25026945
2-[(2-methylpropan-2-yl)oxyamino]ethyl 2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]acetate (PubChem CID 25026945) has the molecular formula C24H35ClN8O5 and a molecular weight of 551.05 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxyamino]ethyl 2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]acetate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxyamino]ethyl 2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]acetate |
|---|---|
| PubChem CID | 25026945 |
| Molecular Formula | C24H35ClN8O5 |
| Molecular Weight | 551.05 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxyamino]ethyl 2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]acetate |
| SMILES | CC(C)(C)ONCCOC(=O)COc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C24H35ClN8O5/c1-24(2,3)38-30-12-13-36-17(34)14-37-16-9-7-15(8-10-16)6-4-5-11-29-23(28)33-22(35)18-20(26)32-21(27)19(25)31-18/h7-10,30H,4-6,11-14H2,1-3H3,(H4,26,27,32)(H3,28,29,33,35) |
| InChIKey | LVEIQCIIMXLELS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 202.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.05 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|