C25H35ClN8O4 — CID 11584763
2-piperidin-1-ylethyl 2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]acetate (PubChem CID 11584763) has the molecular formula C25H35ClN8O4 and a molecular weight of 547.06 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]acetate.
| Compound Name | 2-piperidin-1-ylethyl 2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]acetate |
|---|---|
| PubChem CID | 11584763 |
| Molecular Formula | C25H35ClN8O4 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | 2-piperidin-1-ylethyl 2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]acetate |
| SMILES | N/C(=N\CCCCc1ccc(OCC(=O)OCCN2CCCCC2)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C25H35ClN8O4/c26-21-23(28)32-22(27)20(31-21)24(36)33-25(29)30-11-3-2-6-17-7-9-18(10-8-17)38-16-19(35)37-15-14-34-12-4-1-5-13-34/h7-10H,1-6,11-16H2,(H4,27,28,32)(H3,29,30,33,36) |
| InChIKey | IMPCYEOUNVHKDF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 184.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|