C25H35ClN8O6 — CID 15940217
dimethyl 3-[2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]ethylamino]pentanedioate (PubChem CID 15940217) has the molecular formula C25H35ClN8O6 and a molecular weight of 579.06 g/mol. Its IUPAC name is dimethyl 3-[2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]ethylamino]pentanedioate.
| Compound Name | dimethyl 3-[2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]ethylamino]pentanedioate |
|---|---|
| PubChem CID | 15940217 |
| Molecular Formula | C25H35ClN8O6 |
| Molecular Weight | 579.06 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | dimethyl 3-[2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]ethylamino]pentanedioate |
| SMILES | COC(=O)CC(CC(=O)OC)NCCOc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C25H35ClN8O6/c1-38-18(35)13-16(14-19(36)39-2)30-11-12-40-17-8-6-15(7-9-17)5-3-4-10-31-25(29)34-24(37)20-22(27)33-23(28)21(26)32-20/h6-9,16,30H,3-5,10-14H2,1-2H3,(H4,27,28,33)(H3,29,31,34,37) |
| InChIKey | HCPKOHDMCMYTJA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 219.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.06 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|