C21H31ClN8O4S — CID 11627851
3,5-diamino-6-chloro-N-[N'-[4-[4-[3-(dimethylsulfamoyl)propoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 11627851) has the molecular formula C21H31ClN8O4S and a molecular weight of 527.05 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[3-(dimethylsulfamoyl)propoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[3-(dimethylsulfamoyl)propoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11627851 |
| Molecular Formula | C21H31ClN8O4S |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[3-(dimethylsulfamoyl)propoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)CCCOc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C21H31ClN8O4S/c1-30(2)35(32,33)13-5-12-34-15-9-7-14(8-10-15)6-3-4-11-26-21(25)29-20(31)16-18(23)28-19(24)17(22)27-16/h7-10H,3-6,11-13H2,1-2H3,(H4,23,24,28)(H3,25,26,29,31) |
| InChIKey | XYEFTJOPLAZRSH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 191.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|