C18H22ClN7O4S — CID 130433494
3,5-diamino-6-chloro-N-[N'-[4-(4-methylsulfonylcarbonylphenyl)butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 130433494) has the molecular formula C18H22ClN7O4S and a molecular weight of 467.94 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-(4-methylsulfonylcarbonylphenyl)butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-(4-methylsulfonylcarbonylphenyl)butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 130433494 |
| Molecular Formula | C18H22ClN7O4S |
| Molecular Weight | 467.94 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-(4-methylsulfonylcarbonylphenyl)butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CS(=O)(=O)C(=O)c1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C18H22ClN7O4S/c1-31(29,30)17(28)11-7-5-10(6-8-11)4-2-3-9-23-18(22)26-16(27)12-14(20)25-15(21)13(19)24-12/h5-8H,2-4,9H2,1H3,(H4,20,21,25)(H3,22,23,26,27) |
| InChIKey | IMPVIYRNJSKIFZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 196.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.94 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|