C19H28ClN11O — CID 90988050
3,5-diamino-6-chloro-N-[N'-[4-[4-[(diaminomethylideneamino)-ethylamino]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 90988050) has the molecular formula C19H28ClN11O and a molecular weight of 461.96 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[(diaminomethylideneamino)-ethylamino]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(diaminomethylideneamino)-ethylamino]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90988050 |
| Molecular Formula | C19H28ClN11O |
| Molecular Weight | 461.96 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(diaminomethylideneamino)-ethylamino]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CCN(N=C(N)N)c1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C19H28ClN11O/c1-2-31(30-18(23)24)12-8-6-11(7-9-12)5-3-4-10-26-19(25)29-17(32)13-15(21)28-16(22)14(20)27-13/h6-9H,2-5,10H2,1H3,(H4,21,22,28)(H4,23,24,30)(H3,25,26,29,32) |
| InChIKey | HRSQVZSFMVTVIH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 212.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.96 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|