C21H29ClN8O4 — CID 11598404
methyl 2-amino-4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]butanoate (PubChem CID 11598404) has the molecular formula C21H29ClN8O4 and a molecular weight of 492.97 g/mol. Its IUPAC name is methyl 2-amino-4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]butanoate.
| Compound Name | methyl 2-amino-4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 11598404 |
| Molecular Formula | C21H29ClN8O4 |
| Molecular Weight | 492.97 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | methyl 2-amino-4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]butanoate |
| SMILES | COC(=O)C(N)CCOc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C21H29ClN8O4/c1-33-20(32)14(23)9-11-34-13-7-5-12(6-8-13)4-2-3-10-27-21(26)30-19(31)15-17(24)29-18(25)16(22)28-15/h5-8,14H,2-4,9-11,23H2,1H3,(H4,24,25,29)(H3,26,27,30,31) |
| InChIKey | VCJIFICIEQKNOE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 206.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.97 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|