C22H29ClN8O5 — CID 90896775
methyl (2S)-2-acetamido-3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]propanoate (PubChem CID 90896775) has the molecular formula C22H29ClN8O5 and a molecular weight of 520.98 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]propanoate.
| Compound Name | methyl (2S)-2-acetamido-3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 90896775 |
| Molecular Formula | C22H29ClN8O5 |
| Molecular Weight | 520.98 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | methyl (2S)-2-acetamido-3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]propanoate |
| SMILES | COC(=O)[C@H](COc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1)NC(C)=O |
| InChI | InChI=1S/C22H29ClN8O5/c1-12(32)28-15(21(34)35-2)11-36-14-8-6-13(7-9-14)5-3-4-10-27-22(26)31-20(33)16-18(24)30-19(25)17(23)29-16/h6-9,15H,3-5,10-11H2,1-2H3,(H,28,32)(H4,24,25,30)(H3,26,27,31,33)/t15-/m0/s1 |
| InChIKey | DABVVRYUGVJXHW-HNNXBMFYSA-N |
| XLogP | 0.42 |
| TPSA | 209.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.98 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|