C21H30ClN7O5 — CID 88914995
3-amino-6-chloro-5-(methylamino)-N-[N'-[4-[4-(2,3,4-trihydroxybutoxy)phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 88914995) has the molecular formula C21H30ClN7O5 and a molecular weight of 495.97 g/mol. Its IUPAC name is 3-amino-6-chloro-5-(methylamino)-N-[N'-[4-[4-(2,3,4-trihydroxybutoxy)phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-chloro-5-(methylamino)-N-[N'-[4-[4-(2,3,4-trihydroxybutoxy)phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 88914995 |
| Molecular Formula | C21H30ClN7O5 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 3-amino-6-chloro-5-(methylamino)-N-[N'-[4-[4-(2,3,4-trihydroxybutoxy)phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CNc1nc(N)c(C(=O)N/C(N)=N/CCCCc2ccc(OCC(O)C(O)CO)cc2)nc1Cl |
| InChI | InChI=1S/C21H30ClN7O5/c1-25-19-17(22)27-16(18(23)28-19)20(33)29-21(24)26-9-3-2-4-12-5-7-13(8-6-12)34-11-15(32)14(31)10-30/h5-8,14-15,30-32H,2-4,9-11H2,1H3,(H3,23,25,28)(H3,24,26,29,33) |
| InChIKey | XVQFGNJMNKCZEU-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 201.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|