C24H29ClN8O4 — CID 87145424
3-[6-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]naphthalen-2-yl]oxypropylcarbamic acid (PubChem CID 87145424) has the molecular formula C24H29ClN8O4 and a molecular weight of 529.00 g/mol. Its IUPAC name is 3-[6-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]naphthalen-2-yl]oxypropylcarbamic acid.
| Compound Name | 3-[6-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]naphthalen-2-yl]oxypropylcarbamic acid |
|---|---|
| PubChem CID | 87145424 |
| Molecular Formula | C24H29ClN8O4 |
| Molecular Weight | 529.00 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 3-[6-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]naphthalen-2-yl]oxypropylcarbamic acid |
| SMILES | N/C(=N\CCCCc1ccc2cc(OCCCNC(=O)O)ccc2c1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C24H29ClN8O4/c25-19-21(27)32-20(26)18(31-19)22(34)33-23(28)29-9-2-1-4-14-5-6-16-13-17(8-7-15(16)12-14)37-11-3-10-30-24(35)36/h5-8,12-13,30H,1-4,9-11H2,(H,35,36)(H4,26,27,32)(H3,28,29,33,34) |
| InChIKey | MMIRUMWTCPMAEO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 203.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.00 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|