C26H39ClN8O4 — CID 143046455
3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[4-(2-methyl-1,3-dioxolan-4-yl)butylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 143046455) has the molecular formula C26H39ClN8O4 and a molecular weight of 563.10 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[4-(2-methyl-1,3-dioxolan-4-yl)butylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[4-(2-methyl-1,3-dioxolan-4-yl)butylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 143046455 |
| Molecular Formula | C26H39ClN8O4 |
| Molecular Weight | 563.10 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[4-(2-methyl-1,3-dioxolan-4-yl)butylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CC1OCC(CCCCNCCOc2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)O1 |
| InChI | InChI=1S/C26H39ClN8O4/c1-17-38-16-20(39-17)7-3-4-12-31-14-15-37-19-10-8-18(9-11-19)6-2-5-13-32-26(30)35-25(36)21-23(28)34-24(29)22(27)33-21/h8-11,17,20,31H,2-7,12-16H2,1H3,(H4,28,29,34)(H3,30,32,35,36) |
| InChIKey | NLCMOFVIBJHRAY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 185.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.10 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|