C25H38N8O4 — CID 143046469
3,5-diamino-6-methyl-N-[N'-[4-[4-[2-[[(2R,4R)-2-methyl-1,3-dioxan-4-yl]methylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 143046469) has the molecular formula C25H38N8O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is 3,5-diamino-6-methyl-N-[N'-[4-[4-[2-[[(2R,4R)-2-methyl-1,3-dioxan-4-yl]methylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-methyl-N-[N'-[4-[4-[2-[[(2R,4R)-2-methyl-1,3-dioxan-4-yl]methylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 143046469 |
| Molecular Formula | C25H38N8O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | 3,5-diamino-6-methyl-N-[N'-[4-[4-[2-[[(2R,4R)-2-methyl-1,3-dioxan-4-yl]methylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | Cc1nc(C(=O)N/C(N)=N/CCCCc2ccc(OCCNC[C@H]3CCO[C@@H](C)O3)cc2)c(N)nc1N |
| InChI | InChI=1S/C25H38N8O4/c1-16-22(26)32-23(27)21(31-16)24(34)33-25(28)30-11-4-3-5-18-6-8-19(9-7-18)36-14-12-29-15-20-10-13-35-17(2)37-20/h6-9,17,20,29H,3-5,10-15H2,1-2H3,(H4,26,27,32)(H3,28,30,33,34)/t17-,20-/m1/s1 |
| InChIKey | LNFIIVBHHOMMIX-YLJYHZDGSA-N |
| XLogP | 1.14 |
| TPSA | 185.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|