C22H30IN7O4 — CID 89288717
propan-2-yl 3-[4-[4-[[amino-[(3,5-diamino-6-iodopyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]propanoate (PubChem CID 89288717) has the molecular formula C22H30IN7O4 and a molecular weight of 583.43 g/mol. Its IUPAC name is propan-2-yl 3-[4-[4-[[amino-[(3,5-diamino-6-iodopyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]propanoate.
| Compound Name | propan-2-yl 3-[4-[4-[[amino-[(3,5-diamino-6-iodopyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 89288717 |
| Molecular Formula | C22H30IN7O4 |
| Molecular Weight | 583.43 g/mol |
| Exact Mass | 583.14 |
| IUPAC Name | propan-2-yl 3-[4-[4-[[amino-[(3,5-diamino-6-iodopyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]propanoate |
| SMILES | CC(C)OC(=O)CCOc1ccc(CCCC/N=C(\N)NC(=O)c2nc(I)c(N)nc2N)cc1 |
| InChI | InChI=1S/C22H30IN7O4/c1-13(2)34-16(31)10-12-33-15-8-6-14(7-9-15)5-3-4-11-27-22(26)30-21(32)17-19(24)29-20(25)18(23)28-17/h6-9,13H,3-5,10-12H2,1-2H3,(H4,24,25,29)(H3,26,27,30,32) |
| InChIKey | NUVRKQMWPWBDJQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 180.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|