C21H31N9O2 — CID 143008778
3-amino-N-[N'-[4-[4-[(4Z)-4-amino-4-hydrazinylidenebutoxy]phenyl]butyl]carbamimidoyl]-6-methylpyrazine-2-carboxamide (PubChem CID 143008778) has the molecular formula C21H31N9O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 3-amino-N-[N'-[4-[4-[(4Z)-4-amino-4-hydrazinylidenebutoxy]phenyl]butyl]carbamimidoyl]-6-methylpyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[N'-[4-[4-[(4Z)-4-amino-4-hydrazinylidenebutoxy]phenyl]butyl]carbamimidoyl]-6-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 143008778 |
| Molecular Formula | C21H31N9O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 3-amino-N-[N'-[4-[4-[(4Z)-4-amino-4-hydrazinylidenebutoxy]phenyl]butyl]carbamimidoyl]-6-methylpyrazine-2-carboxamide |
| SMILES | Cc1cnc(N)c(C(=O)N/C(N)=N/CCCCc2ccc(OCCC/C(N)=N/N)cc2)n1 |
| InChI | InChI=1S/C21H31N9O2/c1-14-13-27-19(23)18(28-14)20(31)29-21(24)26-11-3-2-5-15-7-9-16(10-8-15)32-12-4-6-17(22)30-25/h7-10,13H,2-6,11-12,25H2,1H3,(H2,22,30)(H2,23,27)(H3,24,26,29,31) |
| InChIKey | LOOPJIOAIVHLKJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 192.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|