C24H36ClN7O4 — CID 161230889
3,5-diamino-6-chloro-N-[N'-[4-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide;methane (PubChem CID 161230889) has the molecular formula C24H36ClN7O4 and a molecular weight of 522.05 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide;methane.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide;methane |
|---|---|
| PubChem CID | 161230889 |
| Molecular Formula | C24H36ClN7O4 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide;methane |
| SMILES | C.N/C(=N\CCCCc1ccc(OCCOC2CCCCO2)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C23H32ClN7O4.CH4/c24-19-21(26)30-20(25)18(29-19)22(32)31-23(27)28-11-3-1-5-15-7-9-16(10-8-15)33-13-14-35-17-6-2-4-12-34-17;/h7-10,17H,1-6,11-14H2,(H4,25,26,30)(H3,27,28,31,32);1H4 |
| InChIKey | UYSRZCDLKHUUFY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|