C30H46ClN11O5 — CID 121385581
3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[2-[[4-(ethylcarbamoylamino)cyclohexyl]carbamoylamino]ethoxy]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 121385581) has the molecular formula C30H46ClN11O5 and a molecular weight of 676.22 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[2-[[4-(ethylcarbamoylamino)cyclohexyl]carbamoylamino]ethoxy]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[2-[[4-(ethylcarbamoylamino)cyclohexyl]carbamoylamino]ethoxy]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 121385581 |
| Molecular Formula | C30H46ClN11O5 |
| Molecular Weight | 676.22 g/mol |
| Exact Mass | 675.34 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-[2-[[4-(ethylcarbamoylamino)cyclohexyl]carbamoylamino]ethoxy]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CCNC(=O)NC1CCC(NC(=O)NCCOCCOc2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)CC1 |
| InChI | InChI=1S/C30H46ClN11O5/c1-2-35-29(44)38-20-8-10-21(11-9-20)39-30(45)37-15-16-46-17-18-47-22-12-6-19(7-13-22)5-3-4-14-36-28(34)42-27(43)23-25(32)41-26(33)24(31)40-23/h6-7,12-13,20-21H,2-5,8-11,14-18H2,1H3,(H4,32,33,41)(H2,35,38,44)(H2,37,39,45)(H3,34,36,42,43) |
| InChIKey | ZAFYHTJOWCDIPU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 246.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|