C31H45ClN8O7 — CID 158545866
2-[2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]ethoxy]ethyl 2-[4-(ethoxycarbonylamino)cyclohexyl]acetate (PubChem CID 158545866) has the molecular formula C31H45ClN8O7 and a molecular weight of 677.20 g/mol. Its IUPAC name is 2-[2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]ethoxy]ethyl 2-[4-(ethoxycarbonylamino)cyclohexyl]acetate.
| Compound Name | 2-[2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]ethoxy]ethyl 2-[4-(ethoxycarbonylamino)cyclohexyl]acetate |
|---|---|
| PubChem CID | 158545866 |
| Molecular Formula | C31H45ClN8O7 |
| Molecular Weight | 677.20 g/mol |
| Exact Mass | 676.31 |
| IUPAC Name | 2-[2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]ethoxy]ethyl 2-[4-(ethoxycarbonylamino)cyclohexyl]acetate |
| SMILES | CCOC(=O)NC1CCC(CC(=O)OCCOCCOc2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)CC1 |
| InChI | InChI=1S/C31H45ClN8O7/c1-2-45-31(43)37-22-10-6-21(7-11-22)19-24(41)47-18-16-44-15-17-46-23-12-8-20(9-13-23)5-3-4-14-36-30(35)40-29(42)25-27(33)39-28(34)26(32)38-25/h8-9,12-13,21-22H,2-7,10-11,14-19H2,1H3,(H,37,43)(H4,33,34,39)(H3,35,36,40,42) |
| InChIKey | DWBBQGPDQAACGR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 228.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|