C21H31N11O2 — CID 143641268
3,5-diamino-N-[N'-[4-[4-[2-(diaminomethylideneamino)ethylcarbamoyl]phenyl]butyl]carbamimidoyl]-6-methylpyrazine-2-carboxamide (PubChem CID 143641268) has the molecular formula C21H31N11O2 and a molecular weight of 469.55 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[4-[2-(diaminomethylideneamino)ethylcarbamoyl]phenyl]butyl]carbamimidoyl]-6-methylpyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[4-[2-(diaminomethylideneamino)ethylcarbamoyl]phenyl]butyl]carbamimidoyl]-6-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 143641268 |
| Molecular Formula | C21H31N11O2 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[4-[2-(diaminomethylideneamino)ethylcarbamoyl]phenyl]butyl]carbamimidoyl]-6-methylpyrazine-2-carboxamide |
| SMILES | Cc1nc(C(=O)N/C(N)=N/CCCCc2ccc(C(=O)NCCN=C(N)N)cc2)c(N)nc1N |
| InChI | InChI=1S/C21H31N11O2/c1-12-16(22)31-17(23)15(30-12)19(34)32-21(26)29-9-3-2-4-13-5-7-14(8-6-13)18(33)27-10-11-28-20(24)25/h5-8H,2-4,9-11H2,1H3,(H,27,33)(H4,22,23,31)(H4,24,25,28)(H3,26,29,32,34) |
| InChIKey | DRHZJXPHZZIWIM-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 238.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|