C19H31N7O — CID 143641252
3,5-diamino-N-[N'-(4-cyclohexa-1,5-dien-1-ylbutyl)carbamimidoyl]-6-methylpyrazine-2-carboxamide;ethane (PubChem CID 143641252) has the molecular formula C19H31N7O and a molecular weight of 373.51 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-(4-cyclohexa-1,5-dien-1-ylbutyl)carbamimidoyl]-6-methylpyrazine-2-carboxamide;ethane.
| Compound Name | 3,5-diamino-N-[N'-(4-cyclohexa-1,5-dien-1-ylbutyl)carbamimidoyl]-6-methylpyrazine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 143641252 |
| Molecular Formula | C19H31N7O |
| Molecular Weight | 373.51 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 3,5-diamino-N-[N'-(4-cyclohexa-1,5-dien-1-ylbutyl)carbamimidoyl]-6-methylpyrazine-2-carboxamide;ethane |
| SMILES | CC.Cc1nc(C(=O)N/C(N)=N/CCCCC2=CCCC=C2)c(N)nc1N |
| InChI | InChI=1S/C17H25N7O.C2H6/c1-11-14(18)23-15(19)13(22-11)16(25)24-17(20)21-10-6-5-9-12-7-3-2-4-8-12;1-2/h3,7-8H,2,4-6,9-10H2,1H3,(H4,18,19,23)(H3,20,21,24,25);1-2H3 |
| InChIKey | VLRIFHUJTZJWMD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|