C15H27ClN8O — CID 11575881
3,5-diamino-N-[N'-(9-aminononyl)carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 11575881) has the molecular formula C15H27ClN8O and a molecular weight of 370.89 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-(9-aminononyl)carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-(9-aminononyl)carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11575881 |
| Molecular Formula | C15H27ClN8O |
| Molecular Weight | 370.89 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 3,5-diamino-N-[N'-(9-aminononyl)carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | NCCCCCCCCC/N=C(\N)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C15H27ClN8O/c16-11-13(19)23-12(18)10(22-11)14(25)24-15(20)21-9-7-5-3-1-2-4-6-8-17/h1-9,17H2,(H4,18,19,23)(H3,20,21,24,25) |
| InChIKey | SNFDNTBVVCQGFC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 171.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.89 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|